C32H36N2O — CID 70292967
(5S)-5-amino-2-(dibenzylamino)-1,6-diphenylhexan-3-ol (PubChem CID 70292967) has the molecular formula C32H36N2O and a molecular weight of 464.65 g/mol. Its IUPAC name is (5S)-5-amino-2-(dibenzylamino)-1,6-diphenylhexan-3-ol.
| Compound Name | (5S)-5-amino-2-(dibenzylamino)-1,6-diphenylhexan-3-ol |
|---|---|
| PubChem CID | 70292967 |
| Molecular Formula | C32H36N2O |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | (5S)-5-amino-2-(dibenzylamino)-1,6-diphenylhexan-3-ol |
| SMILES | N[C@@H](Cc1ccccc1)CC(O)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H36N2O/c33-30(21-26-13-5-1-6-14-26)23-32(35)31(22-27-15-7-2-8-16-27)34(24-28-17-9-3-10-18-28)25-29-19-11-4-12-20-29/h1-20,30-32,35H,21-25,33H2/t30-,31?,32?/m0/s1 |
| InChIKey | SRVJQTROLWUZRB-NVVYMUDLSA-N |
| XLogP | 5.62 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |