C30H37NO3 — CID 10790107
methyl (2S,4S,5S)-2-benzyl-5-(dibenzylamino)-4-hydroxyoctanoate (PubChem CID 10790107) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is methyl (2S,4S,5S)-2-benzyl-5-(dibenzylamino)-4-hydroxyoctanoate.
| Compound Name | methyl (2S,4S,5S)-2-benzyl-5-(dibenzylamino)-4-hydroxyoctanoate |
|---|---|
| PubChem CID | 10790107 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | methyl (2S,4S,5S)-2-benzyl-5-(dibenzylamino)-4-hydroxyoctanoate |
| SMILES | CCC[C@@H]([C@@H](O)C[C@H](Cc1ccccc1)C(=O)OC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H37NO3/c1-3-13-28(29(32)21-27(30(33)34-2)20-24-14-7-4-8-15-24)31(22-25-16-9-5-10-17-25)23-26-18-11-6-12-19-26/h4-12,14-19,27-29,32H,3,13,20-23H2,1-2H3/t27-,28-,29-/m0/s1 |
| InChIKey | BWOZHGJFMGDKHP-AWCRTANDSA-N |
| XLogP | 5.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |