C24H27Cl2NO — CID 69339752
(2R,3S)-1-chloro-3-(dibenzylamino)-4-phenylbutan-2-ol;hydrochloride (PubChem CID 69339752) has the molecular formula C24H27Cl2NO and a molecular weight of 416.39 g/mol. Its IUPAC name is (2R,3S)-1-chloro-3-(dibenzylamino)-4-phenylbutan-2-ol;hydrochloride.
| Compound Name | (2R,3S)-1-chloro-3-(dibenzylamino)-4-phenylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 69339752 |
| Molecular Formula | C24H27Cl2NO |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (2R,3S)-1-chloro-3-(dibenzylamino)-4-phenylbutan-2-ol;hydrochloride |
| SMILES | Cl.O[C@@H](CCl)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26ClNO.ClH/c25-17-24(27)23(16-20-10-4-1-5-11-20)26(18-21-12-6-2-7-13-21)19-22-14-8-3-9-15-22;/h1-15,23-24,27H,16-19H2;1H/t23-,24-;/m0./s1 |
| InChIKey | PBXKTHHPQVWWSI-UKOKCHKQSA-N |
| XLogP | 5.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|