C37H38NO2P — CID 15315873
(2S,3S,4R)-2-(dibenzylamino)-4-diphenylphosphoryl-1-phenylpentan-3-ol (PubChem CID 15315873) has the molecular formula C37H38NO2P and a molecular weight of 559.69 g/mol. Its IUPAC name is (2S,3S,4R)-2-(dibenzylamino)-4-diphenylphosphoryl-1-phenylpentan-3-ol.
| Compound Name | (2S,3S,4R)-2-(dibenzylamino)-4-diphenylphosphoryl-1-phenylpentan-3-ol |
|---|---|
| PubChem CID | 15315873 |
| Molecular Formula | C37H38NO2P |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | (2S,3S,4R)-2-(dibenzylamino)-4-diphenylphosphoryl-1-phenylpentan-3-ol |
| SMILES | C[C@H]([C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H38NO2P/c1-30(41(40,34-23-13-5-14-24-34)35-25-15-6-16-26-35)37(39)36(27-31-17-7-2-8-18-31)38(28-32-19-9-3-10-20-32)29-33-21-11-4-12-22-33/h2-26,30,36-37,39H,27-29H2,1H3/t30-,36+,37-/m1/s1 |
| InChIKey | ZHFOLWLGRFZIQX-GLNWLRIMSA-N |
| XLogP | 7.06 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|