C32H34N2O2 — CID 142682853
(2R,3S)-3-(dibenzylamino)-2-hydroxy-4-phenyl-N-(2-phenylethyl)butanamide (PubChem CID 142682853) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-2-hydroxy-4-phenyl-N-(2-phenylethyl)butanamide.
| Compound Name | (2R,3S)-3-(dibenzylamino)-2-hydroxy-4-phenyl-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 142682853 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-2-hydroxy-4-phenyl-N-(2-phenylethyl)butanamide |
| SMILES | O=C(NCCc1ccccc1)[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H34N2O2/c35-31(32(36)33-22-21-26-13-5-1-6-14-26)30(23-27-15-7-2-8-16-27)34(24-28-17-9-3-10-18-28)25-29-19-11-4-12-20-29/h1-20,30-31,35H,21-25H2,(H,33,36)/t30-,31+/m0/s1 |
| InChIKey | FJIBYKGUUXBYEQ-IOWSJCHKSA-N |
| XLogP | 5.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |