C14H21NO6 — CID 92529727
(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxy-N-(2-phenylethyl)hexanamide (PubChem CID 92529727) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2,3,4,5,6-pentahydroxy-N-(2-phenylethyl)hexanamide.
| Compound Name | (2R,3R,4R,5S)-2,3,4,5,6-pentahydroxy-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 92529727 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2R,3R,4R,5S)-2,3,4,5,6-pentahydroxy-N-(2-phenylethyl)hexanamide |
| SMILES | O=C(NCCc1ccccc1)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C14H21NO6/c16-8-10(17)11(18)12(19)13(20)14(21)15-7-6-9-4-2-1-3-5-9/h1-5,10-13,16-20H,6-8H2,(H,15,21)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | XVYXITQHMRDBBG-UMSGYPCISA-N |
| XLogP | -2.22 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |