C50H56Cl2N2O12P2Pd — CID 11434748
dichloropalladium;bis((2R,3S,4R,5R)-N-[(4-diphenylphosphanylphenyl)methyl]-2,3,4,5,6-pentahydroxyhexanamide) (PubChem CID 11434748) has the molecular formula C50H56Cl2N2O12P2Pd and a molecular weight of 1116.27 g/mol. Its IUPAC name is dichloropalladium;bis((2R,3S,4R,5R)-N-[(4-diphenylphosphanylphenyl)methyl]-2,3,4,5,6-pentahydroxyhexanamide).
| Compound Name | dichloropalladium;bis((2R,3S,4R,5R)-N-[(4-diphenylphosphanylphenyl)methyl]-2,3,4,5,6-pentahydroxyhexanamide) |
|---|---|
| PubChem CID | 11434748 |
| Molecular Formula | C50H56Cl2N2O12P2Pd |
| Molecular Weight | 1116.27 g/mol |
| Exact Mass | 1114.17 |
| IUPAC Name | dichloropalladium;bis((2R,3S,4R,5R)-N-[(4-diphenylphosphanylphenyl)methyl]-2,3,4,5,6-pentahydroxyhexanamide) |
| SMILES | Cl[Pd]Cl.O=C(NCc1ccc(P(c2ccccc2)c2ccccc2)cc1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(NCc1ccc(P(c2ccccc2)c2ccccc2)cc1)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/2C25H28NO6P.2ClH.Pd/c2*27-16-21(28)22(29)23(30)24(31)25(32)26-15-17-11-13-20(14-12-17)33(18-7-3-1-4-8-18)19-9-5-2-6-10-19;;;/h2*1-14,21-24,27-31H,15-16H2,(H,26,32);2*1H;/q;;;;+2/p-2/t2*21-,22-,23+,24-;;;/m11.../s1 |
| InChIKey | BWIUZSMOFCCNBO-MZUWEXGRSA-L |
| XLogP | 0.37 |
| TPSA | 260.50 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|