C15H19NO7 — CID 101030208
(2S,3R,4S,5R)-6-[(4-ethenylphenyl)methylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 101030208) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2S,3R,4S,5R)-6-[(4-ethenylphenyl)methylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2S,3R,4S,5R)-6-[(4-ethenylphenyl)methylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 101030208 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S,3R,4S,5R)-6-[(4-ethenylphenyl)methylamino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | C=Cc1ccc(CNC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO7/c1-2-8-3-5-9(6-4-8)7-16-14(21)12(19)10(17)11(18)13(20)15(22)23/h2-6,10-13,17-20H,1,7H2,(H,16,21)(H,22,23)/t10-,11+,12+,13-/m0/s1 |
| InChIKey | XTDWIMRUVBRONW-LOWDOPEQSA-N |
| XLogP | -1.53 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |