C13H15NO2 — CID 59550018
N-[(4-ethenylphenyl)methyl]-3-hydroxybut-3-enamide (PubChem CID 59550018) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is N-[(4-ethenylphenyl)methyl]-3-hydroxybut-3-enamide.
| Compound Name | N-[(4-ethenylphenyl)methyl]-3-hydroxybut-3-enamide |
|---|---|
| PubChem CID | 59550018 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[(4-ethenylphenyl)methyl]-3-hydroxybut-3-enamide |
| SMILES | C=Cc1ccc(CNC(=O)CC(=C)O)cc1 |
| InChI | InChI=1S/C13H15NO2/c1-3-11-4-6-12(7-5-11)9-14-13(16)8-10(2)15/h3-7,15H,1-2,8-9H2,(H,14,16) |
| InChIKey | KMOXFJJIKLFVCU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|