C11H10F2NO4S- — CID 154615113
2-[(4-ethenylphenyl)methylamino]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 154615113) has the molecular formula C11H10F2NO4S- and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methylamino]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[(4-ethenylphenyl)methylamino]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 154615113 |
| Molecular Formula | C11H10F2NO4S- |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-[(4-ethenylphenyl)methylamino]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | C=Cc1ccc(CNC(=O)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H11F2NO4S/c1-2-8-3-5-9(6-4-8)7-14-10(15)11(12,13)19(16,17)18/h2-6H,1,7H2,(H,14,15)(H,16,17,18)/p-1 |
| InChIKey | WQPYURXSZSYLLJ-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|