C11H11F2NO6S2 — CID 118906553
methyl 2-[(4-ethenylphenyl)sulfonylsulfamoyl]-2,2-difluoroacetate (PubChem CID 118906553) has the molecular formula C11H11F2NO6S2 and a molecular weight of 355.34 g/mol. Its IUPAC name is methyl 2-[(4-ethenylphenyl)sulfonylsulfamoyl]-2,2-difluoroacetate.
| Compound Name | methyl 2-[(4-ethenylphenyl)sulfonylsulfamoyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 118906553 |
| Molecular Formula | C11H11F2NO6S2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | methyl 2-[(4-ethenylphenyl)sulfonylsulfamoyl]-2,2-difluoroacetate |
| SMILES | C=Cc1ccc(S(=O)(=O)NS(=O)(=O)C(F)(F)C(=O)OC)cc1 |
| InChI | InChI=1S/C11H11F2NO6S2/c1-3-8-4-6-9(7-5-8)21(16,17)14-22(18,19)11(12,13)10(15)20-2/h3-7,14H,1H2,2H3 |
| InChIKey | GSMYECXYYOWLFP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |