C11H14F3NO2S2 — CID 144815079
ethane;N-(4-ethenylphenyl)sulfanyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 144815079) has the molecular formula C11H14F3NO2S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is ethane;N-(4-ethenylphenyl)sulfanyl-1,1,1-trifluoromethanesulfonamide.
| Compound Name | ethane;N-(4-ethenylphenyl)sulfanyl-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 144815079 |
| Molecular Formula | C11H14F3NO2S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | ethane;N-(4-ethenylphenyl)sulfanyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | C=Cc1ccc(SNS(=O)(=O)C(F)(F)F)cc1.CC |
| InChI | InChI=1S/C9H8F3NO2S2.C2H6/c1-2-7-3-5-8(6-4-7)16-13-17(14,15)9(10,11)12;1-2/h2-6,13H,1H2;1-2H3 |
| InChIKey | ZUAUQRYWLILACZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|