C10H8F4O2S2 — CID 91049089
2-(4-ethenylphenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinic acid (PubChem CID 91049089) has the molecular formula C10H8F4O2S2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinic acid.
| Compound Name | 2-(4-ethenylphenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinic acid |
|---|---|
| PubChem CID | 91049089 |
| Molecular Formula | C10H8F4O2S2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 2-(4-ethenylphenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinic acid |
| SMILES | C=Cc1ccc(SC(F)(F)C(F)(F)S(=O)O)cc1 |
| InChI | InChI=1S/C10H8F4O2S2/c1-2-7-3-5-8(6-4-7)17-9(11,12)10(13,14)18(15)16/h2-6H,1H2,(H,15,16) |
| InChIKey | LOSHPNORAFLVHL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|