C17H21F3O2 — CID 158477924
1-tert-butyl-4-ethenylbenzene;trifluoromethyl 2-methylprop-2-enoate (PubChem CID 158477924) has the molecular formula C17H21F3O2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-tert-butyl-4-ethenylbenzene;trifluoromethyl 2-methylprop-2-enoate.
| Compound Name | 1-tert-butyl-4-ethenylbenzene;trifluoromethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158477924 |
| Molecular Formula | C17H21F3O2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-tert-butyl-4-ethenylbenzene;trifluoromethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)F.C=Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H16.C5H5F3O2/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-3(2)4(9)10-5(6,7)8/h5-9H,1H2,2-4H3;1H2,2H3 |
| InChIKey | HHDXASJUMDYEHT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|