C12H12F8O4 — CID 123374776
1,1,3,3,3-pentafluoropropyl 2-methylprop-2-enoate;trifluoromethyl 2-methylprop-2-enoate (PubChem CID 123374776) has the molecular formula C12H12F8O4 and a molecular weight of 372.21 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoropropyl 2-methylprop-2-enoate;trifluoromethyl 2-methylprop-2-enoate.
| Compound Name | 1,1,3,3,3-pentafluoropropyl 2-methylprop-2-enoate;trifluoromethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123374776 |
| Molecular Formula | C12H12F8O4 |
| Molecular Weight | 372.21 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1,1,3,3,3-pentafluoropropyl 2-methylprop-2-enoate;trifluoromethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)CC(F)(F)F.C=C(C)C(=O)OC(F)(F)F |
| InChI | InChI=1S/C7H7F5O2.C5H5F3O2/c1-4(2)5(13)14-7(11,12)3-6(8,9)10;1-3(2)4(9)10-5(6,7)8/h1,3H2,2H3;1H2,2H3 |
| InChIKey | PZNZUDINHJSLGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|