C14H5F21O2 — CID 141413005
1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecan-4-yl 2-methylprop-2-enoate (PubChem CID 141413005) has the molecular formula C14H5F21O2 and a molecular weight of 604.15 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecan-4-yl 2-methylprop-2-enoate.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecan-4-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141413005 |
| Molecular Formula | C14H5F21O2 |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 604.00 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecan-4-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H5F21O2/c1-3(2)4(36)37-12(29,9(23,24)11(27,28)14(33,34)35)8(21,22)6(17,18)5(15,16)7(19,20)10(25,26)13(30,31)32/h1H2,2H3 |
| InChIKey | NWNHDBIDSJEGAK-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|