C7H6F6O3 — CID 174727333
(1,2,2,3,3,3-hexafluoro-1-hydroxypropyl) 2-methylprop-2-enoate (PubChem CID 174727333) has the molecular formula C7H6F6O3 and a molecular weight of 252.11 g/mol. Its IUPAC name is (1,2,2,3,3,3-hexafluoro-1-hydroxypropyl) 2-methylprop-2-enoate.
| Compound Name | (1,2,2,3,3,3-hexafluoro-1-hydroxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174727333 |
| Molecular Formula | C7H6F6O3 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | (1,2,2,3,3,3-hexafluoro-1-hydroxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(O)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O3/c1-3(2)4(14)16-7(13,15)5(8,9)6(10,11)12/h15H,1H2,2H3 |
| InChIKey | DGQQQBJAJFPTPX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|