C10H12F6O2 — CID 150017799
(1,1,2,2,3,3-hexafluoro-4-methylpentyl) 2-methylprop-2-enoate (PubChem CID 150017799) has the molecular formula C10H12F6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is (1,1,2,2,3,3-hexafluoro-4-methylpentyl) 2-methylprop-2-enoate.
| Compound Name | (1,1,2,2,3,3-hexafluoro-4-methylpentyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150017799 |
| Molecular Formula | C10H12F6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (1,1,2,2,3,3-hexafluoro-4-methylpentyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(C)C |
| InChI | InChI=1S/C10H12F6O2/c1-5(2)7(17)18-10(15,16)9(13,14)8(11,12)6(3)4/h6H,1H2,2-4H3 |
| InChIKey | DEPYLPCSUWQOAG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|