C16H17F13O2 — CID 139631410
(1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoro-10-methylundecyl) 2-methylprop-2-enoate (PubChem CID 139631410) has the molecular formula C16H17F13O2 and a molecular weight of 488.28 g/mol. Its IUPAC name is (1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoro-10-methylundecyl) 2-methylprop-2-enoate.
| Compound Name | (1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoro-10-methylundecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139631410 |
| Molecular Formula | C16H17F13O2 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (1,1,2,2,3,3,4,4,5,5,11,11,11-tridecafluoro-10-methylundecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(C)C(F)(F)F |
| InChI | InChI=1S/C16H17F13O2/c1-8(2)10(30)31-16(28,29)15(26,27)14(24,25)13(22,23)11(17,18)7-5-4-6-9(3)12(19,20)21/h9H,1,4-7H2,2-3H3 |
| InChIKey | QRCWSJIAXCVJHG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|