C17H15F17O2 — CID 151782399
[1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-8-(2,2,2-trifluoroethyl)undecyl] 2-methylprop-2-enoate (PubChem CID 151782399) has the molecular formula C17H15F17O2 and a molecular weight of 574.27 g/mol. Its IUPAC name is [1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-8-(2,2,2-trifluoroethyl)undecyl] 2-methylprop-2-enoate.
| Compound Name | [1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-8-(2,2,2-trifluoroethyl)undecyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151782399 |
| Molecular Formula | C17H15F17O2 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | [1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecafluoro-8-(2,2,2-trifluoroethyl)undecyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(CCC)CC(F)(F)F |
| InChI | InChI=1S/C17H15F17O2/c1-4-5-8(6-10(18,19)20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)17(33,34)36-9(35)7(2)3/h8H,2,4-6H2,1,3H3 |
| InChIKey | RUWWFIZXRPLERJ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|