C27H24F12O5 — CID 175498261
2,2-dimethoxy-1,2-diphenylethanone;1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptyl 2-methylprop-2-enoate (PubChem CID 175498261) has the molecular formula C27H24F12O5 and a molecular weight of 656.46 g/mol. Its IUPAC name is 2,2-dimethoxy-1,2-diphenylethanone;1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptyl 2-methylprop-2-enoate.
| Compound Name | 2,2-dimethoxy-1,2-diphenylethanone;1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175498261 |
| Molecular Formula | C27H24F12O5 |
| Molecular Weight | 656.46 g/mol |
| Exact Mass | 656.14 |
| IUPAC Name | 2,2-dimethoxy-1,2-diphenylethanone;1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F.COC(OC)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O3.C11H8F12O2/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13;1-4(2)6(24)25-11(22,23)10(20,21)9(18,19)8(16,17)5(12)3-7(13,14)15/h3-12H,1-2H3;5H,1,3H2,2H3 |
| InChIKey | IKYADCCPMBXGEB-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.46 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|