C13H9F15O2 — CID 142711382
(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluoro-7-methyloctyl) 2-methylprop-2-enoate (PubChem CID 142711382) has the molecular formula C13H9F15O2 and a molecular weight of 482.18 g/mol. Its IUPAC name is (1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluoro-7-methyloctyl) 2-methylprop-2-enoate.
| Compound Name | (1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluoro-7-methyloctyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142711382 |
| Molecular Formula | C13H9F15O2 |
| Molecular Weight | 482.18 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | (1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluoro-7-methyloctyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)C(F)(F)F |
| InChI | InChI=1S/C13H9F15O2/c1-4(2)6(29)30-13(27,28)12(25,26)11(23,24)10(21,22)9(19,20)7(14,15)5(3)8(16,17)18/h5H,1H2,2-3H3 |
| InChIKey | ZOVMIWSBRZLSLL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.18 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|