C14H21F3O4 — CID 159858483
2-methylprop-2-enoic acid;(4,4,4-trifluoro-2,3-dimethylbutan-2-yl) 2-methylprop-2-enoate (PubChem CID 159858483) has the molecular formula C14H21F3O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;(4,4,4-trifluoro-2,3-dimethylbutan-2-yl) 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;(4,4,4-trifluoro-2,3-dimethylbutan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159858483 |
| Molecular Formula | C14H21F3O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-methylprop-2-enoic acid;(4,4,4-trifluoro-2,3-dimethylbutan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)(C)C(C)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2.C4H6O2/c1-6(2)8(14)15-9(4,5)7(3)10(11,12)13;1-3(2)4(5)6/h7H,1H2,2-5H3;1H2,2H3,(H,5,6) |
| InChIKey | NQVKAVRXILUTNM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|