C15H13F15O2 — CID 168875432
1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecyl 2-methylprop-2-enoate (PubChem CID 168875432) has the molecular formula C15H13F15O2 and a molecular weight of 510.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecyl 2-methylprop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168875432 |
| Molecular Formula | C15H13F15O2 |
| Molecular Weight | 510.24 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,11,11,11-pentadecafluoroundecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C15H13F15O2/c1-7(2)8(31)32-15(29,30)14(27,28)13(25,26)12(23,24)11(21,22)9(16,17)5-3-4-6-10(18,19)20/h1,3-6H2,2H3 |
| InChIKey | MVKZNHPURVWPBM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.24 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|