C16H10F20O2 — CID 151533404
1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl 5,5,5-trifluoro-2-methylpent-2-enoate (PubChem CID 151533404) has the molecular formula C16H10F20O2 and a molecular weight of 614.21 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl 5,5,5-trifluoro-2-methylpent-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl 5,5,5-trifluoro-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 151533404 |
| Molecular Formula | C16H10F20O2 |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 614.04 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl 5,5,5-trifluoro-2-methylpent-2-enoate |
| SMILES | CC(=CCC(F)(F)F)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C16H10F20O2/c1-6(2-3-9(19,20)21)7(37)38-16(35,36)15(33,34)14(31,32)13(29,30)12(27,28)11(25,26)8(17,18)4-5-10(22,23)24/h2H,3-5H2,1H3 |
| InChIKey | PWYLENQUWKQYHV-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|