C8H8F6O2 — CID 91244071
trifluoromethyl 6,6,6-trifluoro-2-methylhex-2-enoate (PubChem CID 91244071) has the molecular formula C8H8F6O2 and a molecular weight of 250.14 g/mol. Its IUPAC name is trifluoromethyl 6,6,6-trifluoro-2-methylhex-2-enoate.
| Compound Name | trifluoromethyl 6,6,6-trifluoro-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 91244071 |
| Molecular Formula | C8H8F6O2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | trifluoromethyl 6,6,6-trifluoro-2-methylhex-2-enoate |
| SMILES | CC(=CCCC(F)(F)F)C(=O)OC(F)(F)F |
| InChI | InChI=1S/C8H8F6O2/c1-5(3-2-4-7(9,10)11)6(15)16-8(12,13)14/h3H,2,4H2,1H3 |
| InChIKey | CCDGLLRZXQGNJE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|