About trichloromethyl 5-hydroxy-2-methylpent-2-enoate
trichloromethyl 5-hydroxy-2-methylpent-2-enoate (PubChem CID 57306642) has the molecular formula C7H9Cl3O3
and a molecular weight of 247.50 g/mol. Its IUPAC name is trichloromethyl 5-hydroxy-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | trichloromethyl 5-hydroxy-2-methylpent-2-enoate |
| PubChem CID | 57306642 |
| Molecular Formula | C7H9Cl3O3 |
| Molecular Weight | 247.50 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | trichloromethyl 5-hydroxy-2-methylpent-2-enoate |
| SMILES | CC(=CCCO)C(=O)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H9Cl3O3/c1-5(3-2-4-11)6(12)13-7(8,9)10/h3,11H,2,4H2,1H3 |
| InChIKey | HWMJONQPLYAOON-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trichloromethyl 5-hydroxy-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloromethyl 5-hydroxy-2-methylpent-2-enoate?
The IUPAC name of trichloromethyl 5-hydroxy-2-methylpent-2-enoate (CID 57306642) is trichloromethyl 5-hydroxy-2-methylpent-2-enoate.
What is the SMILES notation for trichloromethyl 5-hydroxy-2-methylpent-2-enoate?
The canonical SMILES for trichloromethyl 5-hydroxy-2-methylpent-2-enoate is CC(=CCCO)C(=O)OC(Cl)(Cl)Cl.
What is the InChIKey of trichloromethyl 5-hydroxy-2-methylpent-2-enoate?
The InChIKey is HWMJONQPLYAOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl3O3/c1-5(3-2-4-11)6(12)13-7(8,9)10/h3,11H,2,4H2,1H3.
What are the key properties of trichloromethyl 5-hydroxy-2-methylpent-2-enoate?
trichloromethyl 5-hydroxy-2-methylpent-2-enoate has a molecular weight of 247.50 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trichloromethyl 5-hydroxy-2-methylpent-2-enoate is sourced from PubChem (CID 57306642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).