C19H23F13O2 — CID 171483137
8,8,9,9,10,10,11,11,12,12,15,15,15-tridecafluoropentadecan-7-yl 2-methylprop-2-enoate (PubChem CID 171483137) has the molecular formula C19H23F13O2 and a molecular weight of 530.37 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,15,15,15-tridecafluoropentadecan-7-yl 2-methylprop-2-enoate.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,15,15,15-tridecafluoropentadecan-7-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171483137 |
| Molecular Formula | C19H23F13O2 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,15,15,15-tridecafluoropentadecan-7-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C19H23F13O2/c1-4-5-6-7-8-12(34-13(33)11(2)3)16(25,26)18(29,30)19(31,32)17(27,28)14(20,21)9-10-15(22,23)24/h12H,2,4-10H2,1,3H3 |
| InChIKey | ADOOQYDYZGASSW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|