C28H42F8O6 — CID 146864028
[6,6,7,7,8,8,9,9-octafluoro-2-(2-methylprop-2-enoyloxymethyl)hexadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate (PubChem CID 146864028) has the molecular formula C28H42F8O6 and a molecular weight of 626.62 g/mol. Its IUPAC name is [6,6,7,7,8,8,9,9-octafluoro-2-(2-methylprop-2-enoyloxymethyl)hexadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate.
| Compound Name | [6,6,7,7,8,8,9,9-octafluoro-2-(2-methylprop-2-enoyloxymethyl)hexadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
|---|---|
| PubChem CID | 146864028 |
| Molecular Formula | C28H42F8O6 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | [6,6,7,7,8,8,9,9-octafluoro-2-(2-methylprop-2-enoyloxymethyl)hexadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
| SMILES | C=C(C)C(=O)OCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC)COC(=O)C(=C)CC(CO)CO |
| InChI | InChI=1S/C28H42F8O6/c1-5-6-7-8-9-12-25(29,30)27(33,34)28(35,36)26(31,32)13-10-11-21(17-41-23(39)19(2)3)18-42-24(40)20(4)14-22(15-37)16-38/h21-22,37-38H,2,4-18H2,1,3H3 |
| InChIKey | SLKCOSXHRSVEBY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|