C16H22F8O3 — CID 153299716
2,2,3,3,4,4,5,5-octafluorododecyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 153299716) has the molecular formula C16H22F8O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluorododecyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluorododecyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 153299716 |
| Molecular Formula | C16H22F8O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluorododecyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC |
| InChI | InChI=1S/C16H22F8O3/c1-3-4-5-6-7-8-13(17,18)15(21,22)16(23,24)14(19,20)10-27-12(26)11(2)9-25/h25H,2-10H2,1H3 |
| InChIKey | VJIHTUAIFDJXCE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|