C9H13F7O2 — CID 152701783
1,2,2,3,3,4,4-heptafluorononane-1,1-diol (PubChem CID 152701783) has the molecular formula C9H13F7O2 and a molecular weight of 286.19 g/mol. Its IUPAC name is 1,2,2,3,3,4,4-heptafluorononane-1,1-diol.
| Compound Name | 1,2,2,3,3,4,4-heptafluorononane-1,1-diol |
|---|---|
| PubChem CID | 152701783 |
| Molecular Formula | C9H13F7O2 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,2,2,3,3,4,4-heptafluorononane-1,1-diol |
| SMILES | CCCCCC(F)(F)C(F)(F)C(F)(F)C(O)(O)F |
| InChI | InChI=1S/C9H13F7O2/c1-2-3-4-5-6(10,11)7(12,13)8(14,15)9(16,17)18/h17-18H,2-5H2,1H3 |
| InChIKey | ZRSSACNTBIPHSK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|