C30H42F12O7 — CID 153299681
[2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecoxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 5-hydroxy-4-(hydroxymethyl)-4-methyl-2-methylidenepentanoate (PubChem CID 153299681) has the molecular formula C30H42F12O7 and a molecular weight of 742.63 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecoxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 5-hydroxy-4-(hydroxymethyl)-4-methyl-2-methylidenepentanoate.
| Compound Name | [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecoxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 5-hydroxy-4-(hydroxymethyl)-4-methyl-2-methylidenepentanoate |
|---|---|
| PubChem CID | 153299681 |
| Molecular Formula | C30H42F12O7 |
| Molecular Weight | 742.63 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | [2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluorotetradecoxymethyl)-3-(2-methylprop-2-enoyloxy)propyl] 5-hydroxy-4-(hydroxymethyl)-4-methyl-2-methylidenepentanoate |
| SMILES | C=C(C)C(=O)OCC(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC)COC(=O)C(=C)CC(C)(CO)CO |
| InChI | InChI=1S/C30H42F12O7/c1-6-7-8-9-10-11-25(31,32)27(35,36)29(39,40)30(41,42)28(37,38)26(33,34)18-47-13-21(14-48-22(45)19(2)3)15-49-23(46)20(4)12-24(5,16-43)17-44/h21,43-44H,2,4,6-18H2,1,3,5H3 |
| InChIKey | ODEBJITVHMOSMW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|