C30H42F12O6 — CID 153299615
[6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)octadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate (PubChem CID 153299615) has the molecular formula C30H42F12O6 and a molecular weight of 726.64 g/mol. Its IUPAC name is [6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)octadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate.
| Compound Name | [6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)octadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
|---|---|
| PubChem CID | 153299615 |
| Molecular Formula | C30H42F12O6 |
| Molecular Weight | 726.64 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | [6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)octadecyl] 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanoate |
| SMILES | C=C(C)C(=O)OCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC)COC(=O)C(=C)CC(CO)CO |
| InChI | InChI=1S/C30H42F12O6/c1-5-6-7-8-9-12-25(31,32)27(35,36)29(39,40)30(41,42)28(37,38)26(33,34)13-10-11-21(17-47-23(45)19(2)3)18-48-24(46)20(4)14-22(15-43)16-44/h21-22,43-44H,2,4-18H2,1,3H3 |
| InChIKey | QVBXJAVOICEMLG-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.64 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|