C23H36F4O6 — CID 134298035
[2-(2,2-difluorooctanoyloxy)-3-(2-methylprop-2-enoyloxy)propyl] 2,2-difluorooctanoate (PubChem CID 134298035) has the molecular formula C23H36F4O6 and a molecular weight of 484.53 g/mol. Its IUPAC name is [2-(2,2-difluorooctanoyloxy)-3-(2-methylprop-2-enoyloxy)propyl] 2,2-difluorooctanoate.
| Compound Name | [2-(2,2-difluorooctanoyloxy)-3-(2-methylprop-2-enoyloxy)propyl] 2,2-difluorooctanoate |
|---|---|
| PubChem CID | 134298035 |
| Molecular Formula | C23H36F4O6 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | [2-(2,2-difluorooctanoyloxy)-3-(2-methylprop-2-enoyloxy)propyl] 2,2-difluorooctanoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(F)(F)CCCCCC)OC(=O)C(F)(F)CCCCCC |
| InChI | InChI=1S/C23H36F4O6/c1-5-7-9-11-13-22(24,25)20(29)32-16-18(15-31-19(28)17(3)4)33-21(30)23(26,27)14-12-10-8-6-2/h18H,3,5-16H2,1-2,4H3 |
| InChIKey | ZAYMLXXJHCRWSM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|