C26H32F12O5 — CID 147472297
[5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)heptadec-16-enyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 147472297) has the molecular formula C26H32F12O5 and a molecular weight of 652.51 g/mol. Its IUPAC name is [5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)heptadec-16-enyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)heptadec-16-enyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 147472297 |
| Molecular Formula | C26H32F12O5 |
| Molecular Weight | 652.51 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | [5,5,6,6,7,7,8,8,9,9,10,10-dodecafluoro-2-(2-methylprop-2-enoyloxymethyl)heptadec-16-enyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(COC(=O)C(=C)C)COC(=O)C(=C)CO |
| InChI | InChI=1S/C26H32F12O5/c1-5-6-7-8-9-11-21(27,28)23(31,32)25(35,36)26(37,38)24(33,34)22(29,30)12-10-18(14-42-19(40)16(2)3)15-43-20(41)17(4)13-39/h5,18,39H,1-2,4,6-15H2,3H3 |
| InChIKey | FCABQQCMDTUMAW-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.51 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|