C11H18O3 — CID 154601466
2-(hydroxymethyl)hex-5-enyl 2-methylprop-2-enoate (PubChem CID 154601466) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2-(hydroxymethyl)hex-5-enyl 2-methylprop-2-enoate.
| Compound Name | 2-(hydroxymethyl)hex-5-enyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154601466 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2-(hydroxymethyl)hex-5-enyl 2-methylprop-2-enoate |
| SMILES | C=CCCC(CO)COC(=O)C(=C)C |
| InChI | InChI=1S/C11H18O3/c1-4-5-6-10(7-12)8-14-11(13)9(2)3/h4,10,12H,1-2,5-8H2,3H3 |
| InChIKey | YTZHEEZTLCYAPG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|