C8H6F8O2 — CID 22610830
1,2,2,3,3,4,4,4-octafluorobutyl 2-methylprop-2-enoate (PubChem CID 22610830) has the molecular formula C8H6F8O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,4-octafluorobutyl 2-methylprop-2-enoate.
| Compound Name | 1,2,2,3,3,4,4,4-octafluorobutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22610830 |
| Molecular Formula | C8H6F8O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 1,2,2,3,3,4,4,4-octafluorobutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F8O2/c1-3(2)4(17)18-5(9)6(10,11)7(12,13)8(14,15)16/h5H,1H2,2H3 |
| InChIKey | AXWDCJVSUPTHGA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|