C11H8F14O3 — CID 87652814
bis(3,3,4,4,5,5,5-heptafluoropentan-2-yl) carbonate (PubChem CID 87652814) has the molecular formula C11H8F14O3 and a molecular weight of 454.15 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,5-heptafluoropentan-2-yl) carbonate.
| Compound Name | bis(3,3,4,4,5,5,5-heptafluoropentan-2-yl) carbonate |
|---|---|
| PubChem CID | 87652814 |
| Molecular Formula | C11H8F14O3 |
| Molecular Weight | 454.15 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | bis(3,3,4,4,5,5,5-heptafluoropentan-2-yl) carbonate |
| SMILES | CC(OC(=O)OC(C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F14O3/c1-3(6(12,13)8(16,17)10(20,21)22)27-5(26)28-4(2)7(14,15)9(18,19)11(23,24)25/h3-4H,1-2H3 |
| InChIKey | AHEBHOJGHJXYRL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.15 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|