C8H11F5O2 — CID 153060888
[(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 2-methylpropanoate (PubChem CID 153060888) has the molecular formula C8H11F5O2 and a molecular weight of 234.16 g/mol. Its IUPAC name is [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 2-methylpropanoate.
| Compound Name | [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 153060888 |
| Molecular Formula | C8H11F5O2 |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [(2S)-3,3,4,4,4-pentafluorobutan-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H](C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F5O2/c1-4(2)6(14)15-5(3)7(9,10)8(11,12)13/h4-5H,1-3H3/t5-/m0/s1 |
| InChIKey | VJKPZKUOJZLDRW-YFKPBYRVSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|