C21H12F26O4 — CID 54006239
bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl) 2-methylidenebutanedioate (PubChem CID 54006239) has the molecular formula C21H12F26O4 and a molecular weight of 822.27 g/mol. Its IUPAC name is bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl) 2-methylidenebutanedioate.
| Compound Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 54006239 |
| Molecular Formula | C21H12F26O4 |
| Molecular Weight | 822.27 g/mol |
| Exact Mass | 822.03 |
| IUPAC Name | bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-2-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H12F26O4/c1-5(9(49)51-7(3)11(24,25)13(28,29)15(32,33)17(36,37)19(40,41)21(45,46)47)4-8(48)50-6(2)10(22,23)12(26,27)14(30,31)16(34,35)18(38,39)20(42,43)44/h6-7H,1,4H2,2-3H3 |
| InChIKey | KPBPZCSIAKHDPD-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.27 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|