C9H7F9O2 — CID 118871733
4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-methylideneheptanoic acid (PubChem CID 118871733) has the molecular formula C9H7F9O2 and a molecular weight of 318.14 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-methylideneheptanoic acid.
| Compound Name | 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-methylideneheptanoic acid |
|---|---|
| PubChem CID | 118871733 |
| Molecular Formula | C9H7F9O2 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-methylideneheptanoic acid |
| SMILES | C=C(C(=O)O)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F9O2/c1-3(5(19)20)4(2)6(10,11)7(12,13)8(14,15)9(16,17)18/h4H,1H2,2H3,(H,19,20) |
| InChIKey | HVOVVIYINCFOFJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|