C8H12O5 — CID 89306236
(2S)-2-hydroxy-2,3-dimethyl-4-methylidenepentanedioic acid (PubChem CID 89306236) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (2S)-2-hydroxy-2,3-dimethyl-4-methylidenepentanedioic acid.
| Compound Name | (2S)-2-hydroxy-2,3-dimethyl-4-methylidenepentanedioic acid |
|---|---|
| PubChem CID | 89306236 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (2S)-2-hydroxy-2,3-dimethyl-4-methylidenepentanedioic acid |
| SMILES | C=C(C(=O)O)C(C)[C@](C)(O)C(=O)O |
| InChI | InChI=1S/C8H12O5/c1-4(6(9)10)5(2)8(3,13)7(11)12/h5,13H,1H2,2-3H3,(H,9,10)(H,11,12)/t5?,8-/m0/s1 |
| InChIKey | DTIAENISPOXGPT-DWHDZERNSA-N |
| XLogP | 0.10 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|