C13H11F17NO2+ — CID 87602018
(1-carboxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-trimethylazanium (PubChem CID 87602018) has the molecular formula C13H11F17NO2+ and a molecular weight of 536.20 g/mol. Its IUPAC name is (1-carboxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-trimethylazanium.
| Compound Name | (1-carboxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-trimethylazanium |
|---|---|
| PubChem CID | 87602018 |
| Molecular Formula | C13H11F17NO2+ |
| Molecular Weight | 536.20 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | (1-carboxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-trimethylazanium |
| SMILES | C[N+](C)(C)C(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F17NO2/c1-31(2,3)4(5(32)33)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4H,1-3H3/p+1 |
| InChIKey | XJKYFYQQYUULLQ-UHFFFAOYSA-O |
| XLogP | 5.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.20 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|