C10H6F15NO2 — CID 10575809
3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoic acid (PubChem CID 10575809) has the molecular formula C10H6F15NO2 and a molecular weight of 457.13 g/mol. Its IUPAC name is 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoic acid.
| Compound Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoic acid |
|---|---|
| PubChem CID | 10575809 |
| Molecular Formula | C10H6F15NO2 |
| Molecular Weight | 457.13 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoic acid |
| SMILES | NC(CC(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F15NO2/c11-4(12,2(26)1-3(27)28)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25/h2H,1,26H2,(H,27,28) |
| InChIKey | WMSJEXLLYUKLQD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|