3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid

C8H3F13O2 — CID 11783764

IUPAC3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid
SMILESO=C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23)
InChIKeyLRWIIEJPCFNNCZ-UHFFFAOYSA-N
MW378.08 g/mol
LogP4.20
Rot. Bonds6

About 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid

3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid (PubChem CID 11783764) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid.

Molecular Properties

Compound Name3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid
PubChem CID11783764
Molecular FormulaC8H3F13O2
Molecular Weight378.08 g/mol
Exact Mass377.99
IUPAC Name3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid
SMILESO=C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23)
InChIKeyLRWIIEJPCFNNCZ-UHFFFAOYSA-N
XLogP4.20
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.08
LogP ≤ 54.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid?
The IUPAC name of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid (CID 11783764) is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid.
What is the SMILES notation for 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid?
The canonical SMILES for 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid is O=C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid?
The InChIKey is LRWIIEJPCFNNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23).
What are the key properties of 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid?
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid has a molecular weight of 378.08 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanoic acid is sourced from PubChem (CID 11783764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).