C10H2F17KO2 — CID 23685990
potassium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanoate (PubChem CID 23685990) has the molecular formula C10H2F17KO2 and a molecular weight of 516.19 g/mol. Its IUPAC name is potassium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanoate.
| Compound Name | potassium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanoate |
|---|---|
| PubChem CID | 23685990 |
| Molecular Formula | C10H2F17KO2 |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 515.94 |
| IUPAC Name | potassium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanoate |
| SMILES | O=C([O-])CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C10H3F17O2.K/c11-3(12,1-2(28)29)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27;/h1H2,(H,28,29);/q;+1/p-1 |
| InChIKey | OEEPRMQBIPRZII-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|