C8H2F13NaO3 — CID 23707431
sodium 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)acetate (PubChem CID 23707431) has the molecular formula C8H2F13NaO3 and a molecular weight of 416.07 g/mol. Its IUPAC name is sodium 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)acetate.
| Compound Name | sodium 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)acetate |
|---|---|
| PubChem CID | 23707431 |
| Molecular Formula | C8H2F13NaO3 |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | sodium 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)acetate |
| SMILES | O=C([O-])COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8H3F13O3.Na/c9-3(10,5(13,14)7(17,18)19)4(11,12)6(15,16)8(20,21)24-1-2(22)23;/h1H2,(H,22,23);/q;+1/p-1 |
| InChIKey | YEXGCKZEKKIRIB-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|