C8F15NaO2 — CID 138396485
sodium 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)hexanoate (PubChem CID 138396485) has the molecular formula C8F15NaO2 and a molecular weight of 436.05 g/mol. Its IUPAC name is sodium 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)hexanoate.
| Compound Name | sodium 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)hexanoate |
|---|---|
| PubChem CID | 138396485 |
| Molecular Formula | C8F15NaO2 |
| Molecular Weight | 436.05 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | sodium 2,3,3,4,4,5,5,6,6,6-decafluoro-2-(1,1,2,2,2-pentafluoroethyl)hexanoate |
| SMILES | O=C([O-])C(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8HF15O2.Na/c9-2(1(24)25,4(12,13)7(18,19)20)3(10,11)5(14,15)6(16,17)8(21,22)23;/h(H,24,25);/q;+1/p-1 |
| InChIKey | UJQUPNIPLJTIOV-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.05 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|