C14H2F24O4 — CID 169091833
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid (PubChem CID 169091833) has the molecular formula C14H2F24O4 and a molecular weight of 690.12 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid |
|---|---|
| PubChem CID | 169091833 |
| Molecular Formula | C14H2F24O4 |
| Molecular Weight | 690.12 g/mol |
| Exact Mass | 689.96 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H2F24O4/c15-4(16,6(19,20)8(23,24)10(27,28)12(31,32)14(36,37)38)3(1(39)40,2(41)42)5(17,18)7(21,22)9(25,26)11(29,30)13(33,34)35/h(H,39,40)(H,41,42) |
| InChIKey | JABPBQJJBKPRQS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.12 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|