C10H2F16O4 — CID 169091830
2-(1,1,2,2,2-pentafluoroethyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid (PubChem CID 169091830) has the molecular formula C10H2F16O4 and a molecular weight of 490.09 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid |
|---|---|
| PubChem CID | 169091830 |
| Molecular Formula | C10H2F16O4 |
| Molecular Weight | 490.09 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H2F16O4/c11-4(12,6(15,16)7(17,18)8(19,20)10(24,25)26)3(1(27)28,2(29)30)5(13,14)9(21,22)23/h(H,27,28)(H,29,30) |
| InChIKey | HUCQYTIVMQUZOX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.09 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|